C33H36N4 — CID 123389102
11-(3,5-dimethyl-4-phenylphenyl)-8,9-diethyl-8,9-dimethyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 123389102) has the molecular formula C33H36N4 and a molecular weight of 488.68 g/mol. Its IUPAC name is 11-(3,5-dimethyl-4-phenylphenyl)-8,9-diethyl-8,9-dimethyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 11-(3,5-dimethyl-4-phenylphenyl)-8,9-diethyl-8,9-dimethyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 123389102 |
| Molecular Formula | C33H36N4 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 11-(3,5-dimethyl-4-phenylphenyl)-8,9-diethyl-8,9-dimethyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CCC1(C)c2ccccc2N2c3nccnc3N(c3cc(C)c(-c4ccccc4)c(C)c3)C2C1(C)CC |
| InChI | InChI=1S/C33H36N4/c1-7-32(5)26-16-12-13-17-27(26)37-30-29(34-18-19-35-30)36(31(37)33(32,6)8-2)25-20-22(3)28(23(4)21-25)24-14-10-9-11-15-24/h9-21,31H,7-8H2,1-6H3 |
| InChIKey | TWAZYPCZJGQRSI-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |