C22H21FN4 — CID 144724858
(10R)-8-fluoro-8,9,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 144724858) has the molecular formula C22H21FN4 and a molecular weight of 360.44 g/mol. Its IUPAC name is (10R)-8-fluoro-8,9,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | (10R)-8-fluoro-8,9,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 144724858 |
| Molecular Formula | C22H21FN4 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (10R)-8-fluoro-8,9,9-trimethyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CC1(F)c2ccccc2N2c3nccnc3N(c3ccccc3)[C@H]2C1(C)C |
| InChI | InChI=1S/C22H21FN4/c1-21(2)20-26(15-9-5-4-6-10-15)18-19(25-14-13-24-18)27(20)17-12-8-7-11-16(17)22(21,3)23/h4-14,20H,1-3H3/t20-,22?/m1/s1 |
| InChIKey | MKBBQTIZCHKTFQ-PSDZMVHGSA-N |
| XLogP | 5.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |