C23H24N4 — CID 144782442
ethene;10,10,14-trimethyl-8-phenyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene (PubChem CID 144782442) has the molecular formula C23H24N4 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethene;10,10,14-trimethyl-8-phenyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene.
| Compound Name | ethene;10,10,14-trimethyl-8-phenyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 144782442 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethene;10,10,14-trimethyl-8-phenyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),12,14-hexaene |
| SMILES | C=C.Cc1ccc2c(c1)N1c3nccnc3N(c3ccccc3)C1C2(C)C |
| InChI | InChI=1S/C21H20N4.C2H4/c1-14-9-10-16-17(13-14)25-19-18(22-11-12-23-19)24(20(25)21(16,2)3)15-7-5-4-6-8-15;1-2/h4-13,20H,1-3H3;1-2H2 |
| InChIKey | CIXJGWVWXPZNEZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|