C36H40N4 — CID 129190543
8-ethenyl-8,9,9-trimethyl-4-phenyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene (PubChem CID 129190543) has the molecular formula C36H40N4 and a molecular weight of 528.74 g/mol. Its IUPAC name is 8-ethenyl-8,9,9-trimethyl-4-phenyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene.
| Compound Name | 8-ethenyl-8,9,9-trimethyl-4-phenyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
|---|---|
| PubChem CID | 129190543 |
| Molecular Formula | C36H40N4 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 8-ethenyl-8,9,9-trimethyl-4-phenyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
| SMILES | C=CC1(C)c2cc(C(C)C)c(-c3ccccc3)cc2N2c3nccnc3N(c3ccc(C(C)C)cc3)C2C1(C)C |
| InChI | InChI=1S/C36H40N4/c1-9-36(8)30-21-28(24(4)5)29(26-13-11-10-12-14-26)22-31(30)40-33-32(37-19-20-38-33)39(34(40)35(36,6)7)27-17-15-25(16-18-27)23(2)3/h9-24,34H,1H2,2-8H3 |
| InChIKey | AGLKWQWXEDGVDI-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|