C30H35N3 — CID 129304962
4-tert-butyl-8-ethenyl-8,9,9-trimethyl-11-(2-methylphenyl)-1,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12(17),13,15-hexaene (PubChem CID 129304962) has the molecular formula C30H35N3 and a molecular weight of 437.63 g/mol. Its IUPAC name is 4-tert-butyl-8-ethenyl-8,9,9-trimethyl-11-(2-methylphenyl)-1,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12(17),13,15-hexaene.
| Compound Name | 4-tert-butyl-8-ethenyl-8,9,9-trimethyl-11-(2-methylphenyl)-1,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 129304962 |
| Molecular Formula | C30H35N3 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 4-tert-butyl-8-ethenyl-8,9,9-trimethyl-11-(2-methylphenyl)-1,11,13-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12(17),13,15-hexaene |
| SMILES | C=CC1(C)c2ccc(C(C)(C)C)cc2N2c3cccnc3N(c3ccccc3C)C2C1(C)C |
| InChI | InChI=1S/C30H35N3/c1-9-30(8)22-17-16-21(28(3,4)5)19-25(22)32-24-15-12-18-31-26(24)33(27(32)29(30,6)7)23-14-11-10-13-20(23)2/h9-19,27H,1H2,2-8H3 |
| InChIKey | PTGLFBGTCSCXTO-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|