C30H38N4 — CID 123961615
5-tert-butyl-8,8,9-triethyl-11-(2-methylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene (PubChem CID 123961615) has the molecular formula C30H38N4 and a molecular weight of 454.66 g/mol. Its IUPAC name is 5-tert-butyl-8,8,9-triethyl-11-(2-methylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene.
| Compound Name | 5-tert-butyl-8,8,9-triethyl-11-(2-methylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
|---|---|
| PubChem CID | 123961615 |
| Molecular Formula | C30H38N4 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 5-tert-butyl-8,8,9-triethyl-11-(2-methylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
| SMILES | CCC1C2N(c3ccccc3C)c3nccnc3N2c2ccc(C(C)(C)C)cc2C1(CC)CC |
| InChI | InChI=1S/C30H38N4/c1-8-22-28-33(24-14-12-11-13-20(24)4)26-27(32-18-17-31-26)34(28)25-16-15-21(29(5,6)7)19-23(25)30(22,9-2)10-3/h11-19,22,28H,8-10H2,1-7H3 |
| InChIKey | AOFKDSDRXIGXGP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |