C31H36N2 — CID 129305053
3-tert-butyl-5-ethenyl-5,6,6-trimethyl-7-(2-methylphenyl)-6aH-benzimidazolo[1,2-a]quinoline (PubChem CID 129305053) has the molecular formula C31H36N2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 3-tert-butyl-5-ethenyl-5,6,6-trimethyl-7-(2-methylphenyl)-6aH-benzimidazolo[1,2-a]quinoline.
| Compound Name | 3-tert-butyl-5-ethenyl-5,6,6-trimethyl-7-(2-methylphenyl)-6aH-benzimidazolo[1,2-a]quinoline |
|---|---|
| PubChem CID | 129305053 |
| Molecular Formula | C31H36N2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 3-tert-butyl-5-ethenyl-5,6,6-trimethyl-7-(2-methylphenyl)-6aH-benzimidazolo[1,2-a]quinoline |
| SMILES | C=CC1(C)c2cc(C(C)(C)C)ccc2N2c3ccccc3N(c3ccccc3C)C2C1(C)C |
| InChI | InChI=1S/C31H36N2/c1-9-31(8)23-20-22(29(3,4)5)18-19-25(23)33-27-17-13-12-16-26(27)32(28(33)30(31,6)7)24-15-11-10-14-21(24)2/h9-20,28H,1H2,2-8H3 |
| InChIKey | PTNIMLXOHLJNHA-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|