C25H30IN2- — CID 148507706
CID 148507706 (PubChem CID 148507706) has the molecular formula C25H30IN2- and a molecular weight of 485.43 g/mol.
| Compound Name | CID 148507706 |
|---|---|
| PubChem CID | 148507706 |
| Molecular Formula | C25H30IN2- |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1N1c2cc(C(C)(C)C)ccc2N(c2ccccc2)[I-]1(C)C |
| InChI | InChI=1S/C25H30IN2/c1-19-12-10-11-15-22(19)28-24-18-20(25(2,3)4)16-17-23(24)27(26(28,5)6)21-13-8-7-9-14-21/h7-18H,1-6H3/q-1 |
| InChIKey | BWIIJGUTVUTJDK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|