C29H36N4 — CID 123635057
9,9-diethyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene (PubChem CID 123635057) has the molecular formula C29H36N4 and a molecular weight of 440.64 g/mol. Its IUPAC name is 9,9-diethyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene.
| Compound Name | 9,9-diethyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
|---|---|
| PubChem CID | 123635057 |
| Molecular Formula | C29H36N4 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 9,9-diethyl-5-propan-2-yl-11-(4-propan-2-ylphenyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,12,14,16-hexaene |
| SMILES | CCC1(CC)Cc2cc(C(C)C)ccc2N2c3nccnc3N(c3ccc(C(C)C)cc3)C21 |
| InChI | InChI=1S/C29H36N4/c1-7-29(8-2)18-23-17-22(20(5)6)11-14-25(23)33-27-26(30-15-16-31-27)32(28(29)33)24-12-9-21(10-13-24)19(3)4/h9-17,19-20,28H,7-8,18H2,1-6H3 |
| InChIKey | GLTXHBKVSLNOHU-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |