C28H26NNaO2 — CID 174534060
sodium;hydride;1-naphthalen-2-yl-5-(4-propan-2-ylphenyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 174534060) has the molecular formula C28H26NNaO2 and a molecular weight of 431.51 g/mol. Its IUPAC name is sodium;hydride;1-naphthalen-2-yl-5-(4-propan-2-ylphenyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | sodium;hydride;1-naphthalen-2-yl-5-(4-propan-2-ylphenyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 174534060 |
| Molecular Formula | C28H26NNaO2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | sodium;hydride;1-naphthalen-2-yl-5-(4-propan-2-ylphenyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CC(C)c1ccc(-c2ccc3c(c2)CC(C(=O)O)N3c2ccc3ccccc3c2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C28H25NO2.Na.H/c1-18(2)19-7-9-21(10-8-19)23-12-14-26-24(15-23)17-27(28(30)31)29(26)25-13-11-20-5-3-4-6-22(20)16-25;;/h3-16,18,27H,17H2,1-2H3,(H,30,31);;/q;+1;-1 |
| InChIKey | UBFLVAVWMFIQOL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |