C13H19NO — CID 90974062
1-methyl-6-propan-2-yl-3,4-dihydro-2H-quinolin-2-ol (PubChem CID 90974062) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-methyl-6-propan-2-yl-3,4-dihydro-2H-quinolin-2-ol.
| Compound Name | 1-methyl-6-propan-2-yl-3,4-dihydro-2H-quinolin-2-ol |
|---|---|
| PubChem CID | 90974062 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-methyl-6-propan-2-yl-3,4-dihydro-2H-quinolin-2-ol |
| SMILES | CC(C)c1ccc2c(c1)CCC(O)N2C |
| InChI | InChI=1S/C13H19NO/c1-9(2)10-4-6-12-11(8-10)5-7-13(15)14(12)3/h4,6,8-9,13,15H,5,7H2,1-3H3 |
| InChIKey | MLIVQRBVWTZDEC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |