C33H30N6 — CID 138723192
8,8,9,9-tetramethyl-11-phenyl-14,15-dipyridin-3-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 138723192) has the molecular formula C33H30N6 and a molecular weight of 510.65 g/mol. Its IUPAC name is 8,8,9,9-tetramethyl-11-phenyl-14,15-dipyridin-3-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 8,8,9,9-tetramethyl-11-phenyl-14,15-dipyridin-3-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 138723192 |
| Molecular Formula | C33H30N6 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 8,8,9,9-tetramethyl-11-phenyl-14,15-dipyridin-3-yl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CC1(C)c2ccccc2N2c3nc(-c4cccnc4)c(-c4cccnc4)nc3N(c3ccccc3)C2C1(C)C |
| InChI | InChI=1S/C33H30N6/c1-32(2)25-16-8-9-17-26(25)39-30-29(38(31(39)33(32,3)4)24-14-6-5-7-15-24)36-27(22-12-10-18-34-20-22)28(37-30)23-13-11-19-35-21-23/h5-21,31H,1-4H3 |
| InChIKey | JTSSXAKEPYHKRT-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |