C22H22FN5O5 — CID 123760435
N-[[(5S)-3-[3-fluoro-4-[3-(2-hydroxyethoxyiminomethyl)imidazo[1,2-a]pyridin-7-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 123760435) has the molecular formula C22H22FN5O5 and a molecular weight of 455.45 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[3-(2-hydroxyethoxyiminomethyl)imidazo[1,2-a]pyridin-7-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[3-(2-hydroxyethoxyiminomethyl)imidazo[1,2-a]pyridin-7-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 123760435 |
| Molecular Formula | C22H22FN5O5 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[3-(2-hydroxyethoxyiminomethyl)imidazo[1,2-a]pyridin-7-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccn4c(C=NOCCO)cnc4c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H22FN5O5/c1-14(30)24-12-18-13-28(22(31)33-18)16-2-3-19(20(23)9-16)15-4-5-27-17(10-25-21(27)8-15)11-26-32-7-6-29/h2-5,8-11,18,29H,6-7,12-13H2,1H3,(H,24,30)/t18-/m0/s1 |
| InChIKey | SKUCGJVPGAQLHY-SFHVURJKSA-N |
| XLogP | 1.94 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|