C11H18F3N3 — CID 123760583
1-(2-butylidenepiperazin-1-yl)-2,2,2-trifluoro-N-methylethanimine (PubChem CID 123760583) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-(2-butylidenepiperazin-1-yl)-2,2,2-trifluoro-N-methylethanimine.
| Compound Name | 1-(2-butylidenepiperazin-1-yl)-2,2,2-trifluoro-N-methylethanimine |
|---|---|
| PubChem CID | 123760583 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(2-butylidenepiperazin-1-yl)-2,2,2-trifluoro-N-methylethanimine |
| SMILES | CCCC=C1CNCCN1/C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N3/c1-3-4-5-9-8-16-6-7-17(9)10(15-2)11(12,13)14/h5,16H,3-4,6-8H2,1-2H3/b9-5?,15-10+ |
| InChIKey | UAGQNZQMPSXLPC-XDKBRYFBSA-N |
| XLogP | 2.17 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|