C13H24N4 — CID 169205013
(Z)-N-methyl-1-piperazin-1-yl-1-[(Z)-prop-1-enyl]iminopent-2-en-2-amine (PubChem CID 169205013) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is (Z)-N-methyl-1-piperazin-1-yl-1-[(Z)-prop-1-enyl]iminopent-2-en-2-amine.
| Compound Name | (Z)-N-methyl-1-piperazin-1-yl-1-[(Z)-prop-1-enyl]iminopent-2-en-2-amine |
|---|---|
| PubChem CID | 169205013 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | (Z)-N-methyl-1-piperazin-1-yl-1-[(Z)-prop-1-enyl]iminopent-2-en-2-amine |
| SMILES | C/C=C\N=C(C(=C/CC)/NC)\N1CCNCC1 |
| InChI | InChI=1S/C13H24N4/c1-4-6-12(14-3)13(16-7-5-2)17-10-8-15-9-11-17/h5-7,14-15H,4,8-11H2,1-3H3/b7-5-,12-6-,16-13+ |
| InChIKey | CWZPSRNQYPVQCH-DFVUNLMVSA-N |
| XLogP | 1.34 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|