C11H19N3 — CID 143094160
2-(1,4-dihydroazepin-7-ylideneamino)-N-ethyl-N-methylethanamine (PubChem CID 143094160) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(1,4-dihydroazepin-7-ylideneamino)-N-ethyl-N-methylethanamine.
| Compound Name | 2-(1,4-dihydroazepin-7-ylideneamino)-N-ethyl-N-methylethanamine |
|---|---|
| PubChem CID | 143094160 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-(1,4-dihydroazepin-7-ylideneamino)-N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CC/N=C1\C=CCC=CN1 |
| InChI | InChI=1S/C11H19N3/c1-3-14(2)10-9-13-11-7-5-4-6-8-12-11/h5-8H,3-4,9-10H2,1-2H3,(H,12,13) |
| InChIKey | KQRNALSJMPQPFZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|