C9H18N2 — CID 142116842
ethane;N-methyl-1,4-dihydroazepin-7-imine;molecular hydrogen (PubChem CID 142116842) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;N-methyl-1,4-dihydroazepin-7-imine;molecular hydrogen.
| Compound Name | ethane;N-methyl-1,4-dihydroazepin-7-imine;molecular hydrogen |
|---|---|
| PubChem CID | 142116842 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;N-methyl-1,4-dihydroazepin-7-imine;molecular hydrogen |
| SMILES | C/N=C1\C=CCC=CN1.CC.[H][H] |
| InChI | InChI=1S/C7H10N2.C2H6.H2/c1-8-7-5-3-2-4-6-9-7;1-2;/h3-6H,2H2,1H3,(H,8,9);1-2H3;1H |
| InChIKey | BXIFOXJZGUFBMM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|