C9H15N3 — CID 123646662
2-N,2-N,5-trimethylazepine-2,5-diamine (PubChem CID 123646662) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-N,2-N,5-trimethylazepine-2,5-diamine.
| Compound Name | 2-N,2-N,5-trimethylazepine-2,5-diamine |
|---|---|
| PubChem CID | 123646662 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-N,2-N,5-trimethylazepine-2,5-diamine |
| SMILES | CN(C)C1=NC=CC(C)(N)C=C1 |
| InChI | InChI=1S/C9H15N3/c1-9(10)5-4-8(12(2)3)11-7-6-9/h4-7H,10H2,1-3H3 |
| InChIKey | XDFAUHSDLQXQSD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |