C11H12N2 — CID 143862134
8,8-dimethylpyrimido[1,2-a]azepine (PubChem CID 143862134) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 8,8-dimethylpyrimido[1,2-a]azepine.
| Compound Name | 8,8-dimethylpyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 143862134 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 8,8-dimethylpyrimido[1,2-a]azepine |
| SMILES | CC1(C)C=CC2=NC=C=CN2C=C1 |
| InChI | InChI=1S/C11H12N2/c1-11(2)5-4-10-12-7-3-8-13(10)9-6-11/h4-9H,1-2H3 |
| InChIKey | QJGJDJILKDQTQW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |