C10H14N2 — CID 145141567
1-ethenyl-N,4-dimethyl-4H-azepin-7-imine (PubChem CID 145141567) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-ethenyl-N,4-dimethyl-4H-azepin-7-imine.
| Compound Name | 1-ethenyl-N,4-dimethyl-4H-azepin-7-imine |
|---|---|
| PubChem CID | 145141567 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-ethenyl-N,4-dimethyl-4H-azepin-7-imine |
| SMILES | C=CN1C=CC(C)C=C/C1=N\C |
| InChI | InChI=1S/C10H14N2/c1-4-12-8-7-9(2)5-6-10(12)11-3/h4-9H,1H2,2-3H3/b11-10+ |
| InChIKey | MTSWMWSONSLMKN-ZHACJKMWSA-N |
| XLogP | 2.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|