C8H13N3 — CID 163776764
5-N,5-dimethylazepine-2,5-diamine (PubChem CID 163776764) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-N,5-dimethylazepine-2,5-diamine.
| Compound Name | 5-N,5-dimethylazepine-2,5-diamine |
|---|---|
| PubChem CID | 163776764 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 5-N,5-dimethylazepine-2,5-diamine |
| SMILES | CNC1(C)C=CN=C(N)C=C1 |
| InChI | InChI=1S/C8H13N3/c1-8(10-2)4-3-7(9)11-6-5-8/h3-6,10H,1-2H3,(H2,9,11) |
| InChIKey | MLDOXGCWVQXLNA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |