C9H11N3 — CID 163915546
4,4-dimethyl-6H-pyrrolo[3,2-d][1,3]diazepine (PubChem CID 163915546) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 4,4-dimethyl-6H-pyrrolo[3,2-d][1,3]diazepine.
| Compound Name | 4,4-dimethyl-6H-pyrrolo[3,2-d][1,3]diazepine |
|---|---|
| PubChem CID | 163915546 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4,4-dimethyl-6H-pyrrolo[3,2-d][1,3]diazepine |
| SMILES | CC1(C)C=c2[nH]ccc2=NC=N1 |
| InChI | InChI=1S/C9H11N3/c1-9(2)5-8-7(3-4-10-8)11-6-12-9/h3-6,10H,1-2H3 |
| InChIKey | QVXREMRTDQTPQJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |