C8H12N2 — CID 142348306
N,5-dimethyl-1,4-dihydroazepin-7-imine (PubChem CID 142348306) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is N,5-dimethyl-1,4-dihydroazepin-7-imine.
| Compound Name | N,5-dimethyl-1,4-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 142348306 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | N,5-dimethyl-1,4-dihydroazepin-7-imine |
| SMILES | C/N=C1\C=C(C)CC=CN1 |
| InChI | InChI=1S/C8H12N2/c1-7-4-3-5-10-8(6-7)9-2/h3,5-6H,4H2,1-2H3,(H,9,10) |
| InChIKey | DTUORZOEDPVQLT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|