C10H16N2 — CID 136614238
3-ethyl-N,6-dimethyl-1,4-dihydroazepin-7-imine (PubChem CID 136614238) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-ethyl-N,6-dimethyl-1,4-dihydroazepin-7-imine.
| Compound Name | 3-ethyl-N,6-dimethyl-1,4-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 136614238 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-ethyl-N,6-dimethyl-1,4-dihydroazepin-7-imine |
| SMILES | CCC1=CN/C(=N\C)C(C)=CC1 |
| InChI | InChI=1S/C10H16N2/c1-4-9-6-5-8(2)10(11-3)12-7-9/h5,7H,4,6H2,1-3H3,(H,11,12) |
| InChIKey | SARCJAZQTXNPLB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|