C11H18N2 — CID 136650330
4-ethyl-N,5,6-trimethyl-1,4-dihydroazepin-7-imine (PubChem CID 136650330) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-ethyl-N,5,6-trimethyl-1,4-dihydroazepin-7-imine.
| Compound Name | 4-ethyl-N,5,6-trimethyl-1,4-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 136650330 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-ethyl-N,5,6-trimethyl-1,4-dihydroazepin-7-imine |
| SMILES | CCC1C=CN/C(=N\C)C(C)=C1C |
| InChI | InChI=1S/C11H18N2/c1-5-10-6-7-13-11(12-4)9(3)8(10)2/h6-7,10H,5H2,1-4H3,(H,12,13) |
| InChIKey | UZZVFLWERWCLIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|