C14H25N3 — CID 123851049
2-methanimidoyl-3-methyl-N-(2-methylbut-1-enyl)-N'-propylbut-2-enimidamide (PubChem CID 123851049) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-methanimidoyl-3-methyl-N-(2-methylbut-1-enyl)-N'-propylbut-2-enimidamide.
| Compound Name | 2-methanimidoyl-3-methyl-N-(2-methylbut-1-enyl)-N'-propylbut-2-enimidamide |
|---|---|
| PubChem CID | 123851049 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-methanimidoyl-3-methyl-N-(2-methylbut-1-enyl)-N'-propylbut-2-enimidamide |
| SMILES | [H]/N=C/C(=C(C)C)/C(=N/CCC)NC=C(C)CC |
| InChI | InChI=1S/C14H25N3/c1-6-8-16-14(13(9-15)11(3)4)17-10-12(5)7-2/h9-10,15H,6-8H2,1-5H3,(H,16,17)/b12-10?,15-9+ |
| InChIKey | YCEWHKOXVCEGCX-URHWOBGYSA-N |
| XLogP | 3.68 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|