About ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen
ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen (PubChem CID 177015123) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen |
| PubChem CID | 177015123 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen |
| SMILES | C/C=C1/C=CN/C1=N\C=N\C.CC.CC.[H][H] |
| InChI | InChI=1S/C8H11N3.2C2H6.H2/c1-3-7-4-5-10-8(7)11-6-9-2;2*1-2;/h3-6H,1-2H3,(H,9,10,11);2*1-2H3;1H/b7-3-;;; |
| InChIKey | WJQUHOMXDMBUGD-RZBDIMBASA-N |
| XLogP | 3.40 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen?
The IUPAC name of ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen (CID 177015123) is ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen.
What is the SMILES notation for ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen?
The canonical SMILES for ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen is C/C=C1/C=CN/C1=N\C=N\C.CC.CC.[H][H].
What is the InChIKey of ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen?
The InChIKey is WJQUHOMXDMBUGD-RZBDIMBASA-N. The full InChI is InChI=1S/C8H11N3.2C2H6.H2/c1-3-7-4-5-10-8(7)11-6-9-2;2*1-2;/h3-6H,1-2H3,(H,9,10,11);2*1-2H3;1H/b7-3-;;;.
What are the key properties of ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen?
ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen has a molecular weight of 211.35 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(3Z)-3-ethylidene-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide;molecular hydrogen is sourced from PubChem (CID 177015123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).