C9H16N2 — CID 168995060
ethene;N-ethenyl-N',2-dimethylprop-2-enimidamide (PubChem CID 168995060) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is ethene;N-ethenyl-N',2-dimethylprop-2-enimidamide.
| Compound Name | ethene;N-ethenyl-N',2-dimethylprop-2-enimidamide |
|---|---|
| PubChem CID | 168995060 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | ethene;N-ethenyl-N',2-dimethylprop-2-enimidamide |
| SMILES | C=C.C=CN/C(=N/C)C(=C)C |
| InChI | InChI=1S/C7H12N2.C2H4/c1-5-9-7(8-4)6(2)3;1-2/h5H,1-2H2,3-4H3,(H,8,9);1-2H2 |
| InChIKey | MOCZCSHBXWNFJF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|