C11H20N2 — CID 168914281
N,4-dimethyl-3-propan-2-ylidene-1H-pyrrol-2-imine;ethane (PubChem CID 168914281) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N,4-dimethyl-3-propan-2-ylidene-1H-pyrrol-2-imine;ethane.
| Compound Name | N,4-dimethyl-3-propan-2-ylidene-1H-pyrrol-2-imine;ethane |
|---|---|
| PubChem CID | 168914281 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,4-dimethyl-3-propan-2-ylidene-1H-pyrrol-2-imine;ethane |
| SMILES | C/N=C1\NC=C(C)C1=C(C)C.CC |
| InChI | InChI=1S/C9H14N2.C2H6/c1-6(2)8-7(3)5-11-9(8)10-4;1-2/h5H,1-4H3,(H,10,11);1-2H3 |
| InChIKey | FWSOJPHTZBDFFR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|