C9H15N2+ — CID 57177363
2,3-bis(prop-1-enyl)-4,5-dihydro-1H-imidazol-3-ium (PubChem CID 57177363) has the molecular formula C9H15N2+ and a molecular weight of 151.23 g/mol. Its IUPAC name is 2,3-bis(prop-1-enyl)-4,5-dihydro-1H-imidazol-3-ium.
| Compound Name | 2,3-bis(prop-1-enyl)-4,5-dihydro-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 57177363 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | 2,3-bis(prop-1-enyl)-4,5-dihydro-1H-imidazol-3-ium |
| SMILES | CC=CC1=[N+](C=CC)CCN1 |
| InChI | InChI=1S/C9H14N2/c1-3-5-9-10-6-8-11(9)7-4-2/h3-5,7H,6,8H2,1-2H3/p+1 |
| InChIKey | YUHIYBRFZDAAOO-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|