C12H22N3+ — CID 67764290
1,2-dihydroazete;1-ethyl-3-methyl-2-prop-2-enyl-4,5-dihydroimidazol-3-ium (PubChem CID 67764290) has the molecular formula C12H22N3+ and a molecular weight of 208.33 g/mol. Its IUPAC name is 1,2-dihydroazete;1-ethyl-3-methyl-2-prop-2-enyl-4,5-dihydroimidazol-3-ium.
| Compound Name | 1,2-dihydroazete;1-ethyl-3-methyl-2-prop-2-enyl-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 67764290 |
| Molecular Formula | C12H22N3+ |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1,2-dihydroazete;1-ethyl-3-methyl-2-prop-2-enyl-4,5-dihydroimidazol-3-ium |
| SMILES | C1=CNC1.C=CCC1=[N+](C)CCN1CC |
| InChI | InChI=1S/C9H17N2.C3H5N/c1-4-6-9-10(3)7-8-11(9)5-2;1-2-4-3-1/h4H,1,5-8H2,2-3H3;1-2,4H,3H2/q+1; |
| InChIKey | IIOUDDMWHFRVCY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|