C11H19N3 — CID 70599547
N-[2-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)ethyl]prop-2-en-1-amine (PubChem CID 70599547) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[2-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 70599547 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-[2-(2-prop-2-enyl-4,5-dihydroimidazol-1-yl)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCN1CCN=C1CC=C |
| InChI | InChI=1S/C11H19N3/c1-3-5-11-13-8-10-14(11)9-7-12-6-4-2/h3-4,12H,1-2,5-10H2 |
| InChIKey | DICBVUDPFARHKG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|