C12H25N3 — CID 142398174
(Z)-N-ethyl-N',3-dimethyl-N-[2-(methylamino)ethyl]pent-2-enimidamide (PubChem CID 142398174) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z)-N-ethyl-N',3-dimethyl-N-[2-(methylamino)ethyl]pent-2-enimidamide.
| Compound Name | (Z)-N-ethyl-N',3-dimethyl-N-[2-(methylamino)ethyl]pent-2-enimidamide |
|---|---|
| PubChem CID | 142398174 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | (Z)-N-ethyl-N',3-dimethyl-N-[2-(methylamino)ethyl]pent-2-enimidamide |
| SMILES | CC/C(C)=C\C(=N/C)N(CC)CCNC |
| InChI | InChI=1S/C12H25N3/c1-6-11(3)10-12(14-5)15(7-2)9-8-13-4/h10,13H,6-9H2,1-5H3/b11-10-,14-12+ |
| InChIKey | XGWKUZILNMYQCV-HSINTONASA-N |
| XLogP | 1.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|