C8H16N2 — CID 142051323
(Z)-N,N',3-trimethylpent-2-enimidamide (PubChem CID 142051323) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (Z)-N,N',3-trimethylpent-2-enimidamide.
| Compound Name | (Z)-N,N',3-trimethylpent-2-enimidamide |
|---|---|
| PubChem CID | 142051323 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (Z)-N,N',3-trimethylpent-2-enimidamide |
| SMILES | CC/C(C)=C\C(=N\C)NC |
| InChI | InChI=1S/C8H16N2/c1-5-7(2)6-8(9-3)10-4/h6H,5H2,1-4H3,(H,9,10)/b7-6- |
| InChIKey | SZVVXAQCHRNYHX-SREVYHEPSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|