C9H20N2O — CID 143230987
(2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide;molecular hydrogen;hydrate (PubChem CID 143230987) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide;molecular hydrogen;hydrate.
| Compound Name | (2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide;molecular hydrogen;hydrate |
|---|---|
| PubChem CID | 143230987 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide;molecular hydrogen;hydrate |
| SMILES | C=C/C(=C\C(=N\C)NC)CC.O.[H][H] |
| InChI | InChI=1S/C9H16N2.H2O.H2/c1-5-8(6-2)7-9(10-3)11-4;;/h5,7H,1,6H2,2-4H3,(H,10,11);1H2;1H/b8-7+;; |
| InChIKey | MZZFVYBKZHXXND-MIIBGCIDSA-N |
| XLogP | 1.18 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|