C12H20N2 — CID 171555081
ethene;(2Z)-3-ethenyl-N,N',4-trimethylpenta-2,4-dienimidamide (PubChem CID 171555081) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethene;(2Z)-3-ethenyl-N,N',4-trimethylpenta-2,4-dienimidamide.
| Compound Name | ethene;(2Z)-3-ethenyl-N,N',4-trimethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 171555081 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethene;(2Z)-3-ethenyl-N,N',4-trimethylpenta-2,4-dienimidamide |
| SMILES | C=C.C=C/C(=C/C(=N/C)NC)C(=C)C |
| InChI | InChI=1S/C10H16N2.C2H4/c1-6-9(8(2)3)7-10(11-4)12-5;1-2/h6-7H,1-2H2,3-5H3,(H,11,12);1-2H2/b9-7-; |
| InChIKey | JFWUCIPMUQRJKW-VILQZVERSA-N |
| XLogP | 2.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|