C11H18N2 — CID 134286810
(3Z,5Z)-N'-methyl-7-methylidenenona-3,5-dienimidamide (PubChem CID 134286810) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3Z,5Z)-N'-methyl-7-methylidenenona-3,5-dienimidamide.
| Compound Name | (3Z,5Z)-N'-methyl-7-methylidenenona-3,5-dienimidamide |
|---|---|
| PubChem CID | 134286810 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3Z,5Z)-N'-methyl-7-methylidenenona-3,5-dienimidamide |
| SMILES | C=C(/C=C\C=C/C/C(N)=N/C)CC |
| InChI | InChI=1S/C11H18N2/c1-4-10(2)8-6-5-7-9-11(12)13-3/h5-8H,2,4,9H2,1,3H3,(H2,12,13)/b7-5-,8-6- |
| InChIKey | GHKSTVYXNZTWRB-SFECMWDFSA-N |
| XLogP | 2.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|