C11H18N4 — CID 123811047
(Z,2E)-N'-carbamimidoyl-2-ethylidene-5-methylidenehept-3-enimidamide (PubChem CID 123811047) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is (Z,2E)-N'-carbamimidoyl-2-ethylidene-5-methylidenehept-3-enimidamide.
| Compound Name | (Z,2E)-N'-carbamimidoyl-2-ethylidene-5-methylidenehept-3-enimidamide |
|---|---|
| PubChem CID | 123811047 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (Z,2E)-N'-carbamimidoyl-2-ethylidene-5-methylidenehept-3-enimidamide |
| SMILES | [H]/N=C(\N)N=C(N)C(/C=C\C(=C)CC)=C/C |
| InChI | InChI=1S/C11H18N4/c1-4-8(3)6-7-9(5-2)10(12)15-11(13)14/h5-7H,3-4H2,1-2H3,(H5,12,13,14,15)/b7-6-,9-5+ |
| InChIKey | PYKACIJUPIWGDH-QRLJIZSYSA-N |
| XLogP | 1.71 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|