C10H17N5 — CID 123462386
(Z)-N'-carbamimidoyl-5-methylidene-2-methyliminohept-3-enimidamide (PubChem CID 123462386) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is (Z)-N'-carbamimidoyl-5-methylidene-2-methyliminohept-3-enimidamide.
| Compound Name | (Z)-N'-carbamimidoyl-5-methylidene-2-methyliminohept-3-enimidamide |
|---|---|
| PubChem CID | 123462386 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | (Z)-N'-carbamimidoyl-5-methylidene-2-methyliminohept-3-enimidamide |
| SMILES | [H]/N=C(\N)N=C(N)C(/C=C\C(=C)CC)=N\C |
| InChI | InChI=1S/C10H17N5/c1-4-7(2)5-6-8(14-3)9(11)15-10(12)13/h5-6H,2,4H2,1,3H3,(H5,11,12,13,15)/b6-5-,14-8- |
| InChIKey | PGOUMHYZIMWMJU-DICXBPMKSA-N |
| XLogP | 0.83 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|