C12H21N3 — CID 143470292
(2E,3Z)-N-(1-aminoethylidene)-2-ethylidenehexa-3,5-dienimidamide;ethane (PubChem CID 143470292) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (2E,3Z)-N-(1-aminoethylidene)-2-ethylidenehexa-3,5-dienimidamide;ethane.
| Compound Name | (2E,3Z)-N-(1-aminoethylidene)-2-ethylidenehexa-3,5-dienimidamide;ethane |
|---|---|
| PubChem CID | 143470292 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (2E,3Z)-N-(1-aminoethylidene)-2-ethylidenehexa-3,5-dienimidamide;ethane |
| SMILES | CC.[H]/N=C(\N=C(/C)N)C(/C=C\C=C)=C/C |
| InChI | InChI=1S/C10H15N3.C2H6/c1-4-6-7-9(5-2)10(12)13-8(3)11;1-2/h4-7H,1H2,2-3H3,(H3,11,12,13);1-2H3/b7-6-,9-5+; |
| InChIKey | MXLHKFZDSBIKEP-YVCPEMMASA-N |
| XLogP | 3.06 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|