C19H28N2 — CID 142608345
ethane;N'-methyl-N-[(4Z,8Z)-3,6,7-trimethylideneundeca-4,8,10-trien-2-ylidene]ethanimidamide (PubChem CID 142608345) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is ethane;N'-methyl-N-[(4Z,8Z)-3,6,7-trimethylideneundeca-4,8,10-trien-2-ylidene]ethanimidamide.
| Compound Name | ethane;N'-methyl-N-[(4Z,8Z)-3,6,7-trimethylideneundeca-4,8,10-trien-2-ylidene]ethanimidamide |
|---|---|
| PubChem CID | 142608345 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | ethane;N'-methyl-N-[(4Z,8Z)-3,6,7-trimethylideneundeca-4,8,10-trien-2-ylidene]ethanimidamide |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C\C(=C)/C(C)=N/C(C)=N/C.CC |
| InChI | InChI=1S/C17H22N2.C2H6/c1-8-9-10-13(2)14(3)11-12-15(4)16(5)19-17(6)18-7;1-2/h8-12H,1-4H2,5-7H3;1-2H3/b10-9-,12-11-,18-17+,19-16+; |
| InChIKey | PGDXHINEZCMKTE-VJFAACKYSA-N |
| XLogP | 5.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|