C10H12ClFN2 — CID 142498574
(NZ)-N-[(4E)-5-fluoro-2-methylhepta-1,4,6-trien-3-ylidene]-N'-methylcarbamimidoyl chloride (PubChem CID 142498574) has the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. Its IUPAC name is (NZ)-N-[(4E)-5-fluoro-2-methylhepta-1,4,6-trien-3-ylidene]-N'-methylcarbamimidoyl chloride.
| Compound Name | (NZ)-N-[(4E)-5-fluoro-2-methylhepta-1,4,6-trien-3-ylidene]-N'-methylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 142498574 |
| Molecular Formula | C10H12ClFN2 |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (NZ)-N-[(4E)-5-fluoro-2-methylhepta-1,4,6-trien-3-ylidene]-N'-methylcarbamimidoyl chloride |
| SMILES | C=C/C(F)=C\C(=N\C(Cl)=N\C)C(=C)C |
| InChI | InChI=1S/C10H12ClFN2/c1-5-8(12)6-9(7(2)3)14-10(11)13-4/h5-6H,1-2H2,3-4H3/b8-6+,13-10+,14-9- |
| InChIKey | RGBPNKSVUDDDDN-JFYPOKMJSA-N |
| XLogP | 3.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|