C16H26N2 — CID 123272046
(3Z)-1-N,8-dimethyl-2-N-propylundeca-3,7,9-triene-1,2-diimine (PubChem CID 123272046) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (3Z)-1-N,8-dimethyl-2-N-propylundeca-3,7,9-triene-1,2-diimine.
| Compound Name | (3Z)-1-N,8-dimethyl-2-N-propylundeca-3,7,9-triene-1,2-diimine |
|---|---|
| PubChem CID | 123272046 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (3Z)-1-N,8-dimethyl-2-N-propylundeca-3,7,9-triene-1,2-diimine |
| SMILES | CC=CC(C)=CCC/C=C\C(\C=N\C)=N\CCC |
| InChI | InChI=1S/C16H26N2/c1-5-10-15(3)11-8-7-9-12-16(14-17-4)18-13-6-2/h5,9-12,14H,6-8,13H2,1-4H3/b10-5?,12-9-,15-11?,17-14+,18-16- |
| InChIKey | TYZJKDCISHFQGU-OLBMBNRESA-N |
| XLogP | 4.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|