C9H18N2 — CID 166106802
(E)-N,N',3,4-tetramethylpent-2-enimidamide (PubChem CID 166106802) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (E)-N,N',3,4-tetramethylpent-2-enimidamide.
| Compound Name | (E)-N,N',3,4-tetramethylpent-2-enimidamide |
|---|---|
| PubChem CID | 166106802 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (E)-N,N',3,4-tetramethylpent-2-enimidamide |
| SMILES | C/N=C(/C=C(\C)C(C)C)NC |
| InChI | InChI=1S/C9H18N2/c1-7(2)8(3)6-9(10-4)11-5/h6-7H,1-5H3,(H,10,11)/b8-6+ |
| InChIKey | ROMFDFRUUJFGTD-SOFGYWHQSA-N |
| XLogP | 1.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|