C8H13F3N2 — CID 143155770
(E)-5,5,5-trifluoro-N,N',3-trimethylpent-2-enimidamide (PubChem CID 143155770) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-N,N',3-trimethylpent-2-enimidamide.
| Compound Name | (E)-5,5,5-trifluoro-N,N',3-trimethylpent-2-enimidamide |
|---|---|
| PubChem CID | 143155770 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (E)-5,5,5-trifluoro-N,N',3-trimethylpent-2-enimidamide |
| SMILES | C/N=C(/C=C(\C)CC(F)(F)F)NC |
| InChI | InChI=1S/C8H13F3N2/c1-6(5-8(9,10)11)4-7(12-2)13-3/h4H,5H2,1-3H3,(H,12,13)/b6-4+ |
| InChIKey | DRSUYXZBTXGYLG-GQCTYLIASA-N |
| XLogP | 2.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|