C7H14N2 — CID 142369047
(Z)-N,N'-dimethylpent-2-enimidamide (PubChem CID 142369047) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (Z)-N,N'-dimethylpent-2-enimidamide.
| Compound Name | (Z)-N,N'-dimethylpent-2-enimidamide |
|---|---|
| PubChem CID | 142369047 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (Z)-N,N'-dimethylpent-2-enimidamide |
| SMILES | CC/C=C\C(=N\C)NC |
| InChI | InChI=1S/C7H14N2/c1-4-5-6-7(8-2)9-3/h5-6H,4H2,1-3H3,(H,8,9)/b6-5- |
| InChIKey | BBGSQQOHPLBGKL-WAYWQWQTSA-N |
| XLogP | 1.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|