C9H16N2 — CID 143230988
(2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide (PubChem CID 143230988) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 143230988 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2Z)-3-ethyl-N,N'-dimethylpenta-2,4-dienimidamide |
| SMILES | C=C/C(=C\C(=N\C)NC)CC |
| InChI | InChI=1S/C9H16N2/c1-5-8(6-2)7-9(10-3)11-4/h5,7H,1,6H2,2-4H3,(H,10,11)/b8-7+ |
| InChIKey | PSVHNLYZXUXGFC-BQYQJAHWSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|