C15H31N3 — CID 123761400
N',N'-diethyl-N-(5-methylidene-6-propan-2-ylpiperidin-2-yl)ethane-1,2-diamine (PubChem CID 123761400) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is N',N'-diethyl-N-(5-methylidene-6-propan-2-ylpiperidin-2-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(5-methylidene-6-propan-2-ylpiperidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123761400 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N',N'-diethyl-N-(5-methylidene-6-propan-2-ylpiperidin-2-yl)ethane-1,2-diamine |
| SMILES | C=C1CCC(NCCN(CC)CC)NC1C(C)C |
| InChI | InChI=1S/C15H31N3/c1-6-18(7-2)11-10-16-14-9-8-13(5)15(17-14)12(3)4/h12,14-17H,5-11H2,1-4H3 |
| InChIKey | DFJUUPLZBXELIV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|