C10H23N3 — CID 130439995
1-N-(aminomethyl)-6-methyl-5-methylideneheptane-1,4-diamine (PubChem CID 130439995) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-N-(aminomethyl)-6-methyl-5-methylideneheptane-1,4-diamine.
| Compound Name | 1-N-(aminomethyl)-6-methyl-5-methylideneheptane-1,4-diamine |
|---|---|
| PubChem CID | 130439995 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-N-(aminomethyl)-6-methyl-5-methylideneheptane-1,4-diamine |
| SMILES | C=C(C(C)C)C(N)CCCNCN |
| InChI | InChI=1S/C10H23N3/c1-8(2)9(3)10(12)5-4-6-13-7-11/h8,10,13H,3-7,11-12H2,1-2H3 |
| InChIKey | LOGDBRIEBIMEMD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|