C11H25N3 — CID 91034521
1-N-(1-aminoethyl)-4-ethylhept-6-ene-1,5-diamine (PubChem CID 91034521) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-N-(1-aminoethyl)-4-ethylhept-6-ene-1,5-diamine.
| Compound Name | 1-N-(1-aminoethyl)-4-ethylhept-6-ene-1,5-diamine |
|---|---|
| PubChem CID | 91034521 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 1-N-(1-aminoethyl)-4-ethylhept-6-ene-1,5-diamine |
| SMILES | C=CC(N)C(CC)CCCNC(C)N |
| InChI | InChI=1S/C11H25N3/c1-4-10(11(13)5-2)7-6-8-14-9(3)12/h5,9-11,14H,2,4,6-8,12-13H2,1,3H3 |
| InChIKey | MJGBAVOCVUMTEZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|